C34H46O6 — CID 101463698
(10-acetyloxy-1,5-dioctoxyanthracen-9-yl) acetate (PubChem CID 101463698) has the molecular formula C34H46O6 and a molecular weight of 550.74 g/mol. Its IUPAC name is (10-acetyloxy-1,5-dioctoxyanthracen-9-yl) acetate.
| Compound Name | (10-acetyloxy-1,5-dioctoxyanthracen-9-yl) acetate |
|---|---|
| PubChem CID | 101463698 |
| Molecular Formula | C34H46O6 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | (10-acetyloxy-1,5-dioctoxyanthracen-9-yl) acetate |
| SMILES | CCCCCCCCOc1cccc2c(OC(C)=O)c3c(OCCCCCCCC)cccc3c(OC(C)=O)c12 |
| InChI | InChI=1S/C34H46O6/c1-5-7-9-11-13-15-23-37-29-21-17-19-27-31(29)33(39-25(3)35)28-20-18-22-30(32(28)34(27)40-26(4)36)38-24-16-14-12-10-8-6-2/h17-22H,5-16,23-24H2,1-4H3 |
| InChIKey | ORLKODAUCJNIKB-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|