C20H23NO2 — CID 22444369
3-[(E)-6-(1,3-dioxolan-2-yl)-1-phenylhex-4-enyl]pyridine (PubChem CID 22444369) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[(E)-6-(1,3-dioxolan-2-yl)-1-phenylhex-4-enyl]pyridine.
| Compound Name | 3-[(E)-6-(1,3-dioxolan-2-yl)-1-phenylhex-4-enyl]pyridine |
|---|---|
| PubChem CID | 22444369 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-[(E)-6-(1,3-dioxolan-2-yl)-1-phenylhex-4-enyl]pyridine |
| SMILES | C(=C/CC1OCCO1)\CCC(c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C20H23NO2/c1-3-8-17(9-4-1)19(18-10-7-13-21-16-18)11-5-2-6-12-20-22-14-15-23-20/h1-4,6-10,13,16,19-20H,5,11-12,14-15H2/b6-2+ |
| InChIKey | XEHQUCUQKWKBMP-QHHAFSJGSA-N |
| XLogP | 4.31 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|