C21H23NO4 — CID 19606598
(4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid (PubChem CID 19606598) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid.
| Compound Name | (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid |
|---|---|
| PubChem CID | 19606598 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid |
| SMILES | NC(C/C(=C\CCC(c1ccccc1)c1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H23NO4/c22-19(21(25)26)14-17(20(23)24)12-7-13-18(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-12,18-19H,7,13-14,22H2,(H,23,24)(H,25,26)/b17-12+ |
| InChIKey | OQHKCNWWRJOZCR-SFQUDFHCSA-N |
| XLogP | 3.41 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|