(4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid

C21H23NO4 — CID 19606598

IUPAC(4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid
SMILESNC(C/C(=C\CCC(c1ccccc1)c1ccccc1)C(=O)O)C(=O)O
InChIInChI=1S/C21H23NO4/c22-19(21(25)26)14-17(20(23)24)12-7-13-18(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-12,18-19H,7,13-14,22H2,(H,23,24)(H,25,26)/b17-12+
InChIKeyOQHKCNWWRJOZCR-SFQUDFHCSA-N
MW353.42 g/mol
LogP3.41
Rot. Bonds9

About (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid

(4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid (PubChem CID 19606598) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid.

Molecular Properties

Compound Name(4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid
PubChem CID19606598
Molecular FormulaC21H23NO4
Molecular Weight353.42 g/mol
Exact Mass353.16
IUPAC Name(4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid
SMILESNC(C/C(=C\CCC(c1ccccc1)c1ccccc1)C(=O)O)C(=O)O
InChIInChI=1S/C21H23NO4/c22-19(21(25)26)14-17(20(23)24)12-7-13-18(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-12,18-19H,7,13-14,22H2,(H,23,24)(H,25,26)/b17-12+
InChIKeyOQHKCNWWRJOZCR-SFQUDFHCSA-N
XLogP3.41
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.42
LogP ≤ 53.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid?
The IUPAC name of (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid (CID 19606598) is (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid.
What is the SMILES notation for (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid?
The canonical SMILES for (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid is NC(C/C(=C\CCC(c1ccccc1)c1ccccc1)C(=O)O)C(=O)O.
What is the InChIKey of (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid?
The InChIKey is OQHKCNWWRJOZCR-SFQUDFHCSA-N. The full InChI is InChI=1S/C21H23NO4/c22-19(21(25)26)14-17(20(23)24)12-7-13-18(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-12,18-19H,7,13-14,22H2,(H,23,24)(H,25,26)/b17-12+.
What are the key properties of (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid?
(4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid has a molecular weight of 353.42 g/mol, XLogP of 3.41, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-amino-4-(4,4-diphenylbutylidene)pentanedioic acid is sourced from PubChem (CID 19606598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).