C12H14ClNO4 — CID 10880215
(2R,4S)-2-amino-4-[(2-chlorophenyl)methyl]pentanedioic acid (PubChem CID 10880215) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is (2R,4S)-2-amino-4-[(2-chlorophenyl)methyl]pentanedioic acid.
| Compound Name | (2R,4S)-2-amino-4-[(2-chlorophenyl)methyl]pentanedioic acid |
|---|---|
| PubChem CID | 10880215 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (2R,4S)-2-amino-4-[(2-chlorophenyl)methyl]pentanedioic acid |
| SMILES | N[C@H](C[C@H](Cc1ccccc1Cl)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H14ClNO4/c13-9-4-2-1-3-7(9)5-8(11(15)16)6-10(14)12(17)18/h1-4,8,10H,5-6,14H2,(H,15,16)(H,17,18)/t8-,10+/m0/s1 |
| InChIKey | RXBYSOOCBXEQKT-WCBMZHEXSA-N |
| XLogP | 1.39 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |