C18H15ClO2 — CID 79422249
2-[(2-chlorophenyl)methyl]-5-phenylpent-4-ynoic acid (PubChem CID 79422249) has the molecular formula C18H15ClO2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-5-phenylpent-4-ynoic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl]-5-phenylpent-4-ynoic acid |
|---|---|
| PubChem CID | 79422249 |
| Molecular Formula | C18H15ClO2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-5-phenylpent-4-ynoic acid |
| SMILES | O=C(O)C(CC#Cc1ccccc1)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H15ClO2/c19-17-12-5-4-10-15(17)13-16(18(20)21)11-6-9-14-7-2-1-3-8-14/h1-5,7-8,10,12,16H,11,13H2,(H,20,21) |
| InChIKey | MWYQFFQMHWRHQR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|