C20H17ClN2O2 — CID 102417715
8-pyridin-3-ylocta-5,7-diynyl N-(4-chlorophenyl)carbamate (PubChem CID 102417715) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is 8-pyridin-3-ylocta-5,7-diynyl N-(4-chlorophenyl)carbamate.
| Compound Name | 8-pyridin-3-ylocta-5,7-diynyl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 102417715 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 8-pyridin-3-ylocta-5,7-diynyl N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)OCCCCC#CC#Cc1cccnc1 |
| InChI | InChI=1S/C20H17ClN2O2/c21-18-10-12-19(13-11-18)23-20(24)25-15-6-4-2-1-3-5-8-17-9-7-14-22-16-17/h7,9-14,16H,2,4,6,15H2,(H,23,24) |
| InChIKey | XEYUNOWTRVROFN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|