C40H56N2O4 — CID 100958213
22-[[(1S)-1-phenylethyl]carbamoyloxy]docosa-10,12-diynyl N-[(1S)-1-phenylethyl]carbamate (PubChem CID 100958213) has the molecular formula C40H56N2O4 and a molecular weight of 628.90 g/mol. Its IUPAC name is 22-[[(1S)-1-phenylethyl]carbamoyloxy]docosa-10,12-diynyl N-[(1S)-1-phenylethyl]carbamate.
| Compound Name | 22-[[(1S)-1-phenylethyl]carbamoyloxy]docosa-10,12-diynyl N-[(1S)-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 100958213 |
| Molecular Formula | C40H56N2O4 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 628.42 |
| IUPAC Name | 22-[[(1S)-1-phenylethyl]carbamoyloxy]docosa-10,12-diynyl N-[(1S)-1-phenylethyl]carbamate |
| SMILES | C[C@H](NC(=O)OCCCCCCCCCC#CC#CCCCCCCCCCOC(=O)N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H56N2O4/c1-35(37-29-23-21-24-30-37)41-39(43)45-33-27-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-28-34-46-40(44)42-36(2)38-31-25-22-26-32-38/h21-26,29-32,35-36H,7-20,27-28,33-34H2,1-2H3,(H,41,43)(H,42,44)/t35-,36-/m0/s1 |
| InChIKey | YTCSQXCMMLHIII-ZPGRZCPFSA-N |
| XLogP | 10.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|