C34H44N2O2 — CID 122396219
N,N'-bis[1-(4-methylphenyl)ethyl]hexadeca-7,9-diynediamide (PubChem CID 122396219) has the molecular formula C34H44N2O2 and a molecular weight of 512.74 g/mol. Its IUPAC name is N,N'-bis[1-(4-methylphenyl)ethyl]hexadeca-7,9-diynediamide.
| Compound Name | N,N'-bis[1-(4-methylphenyl)ethyl]hexadeca-7,9-diynediamide |
|---|---|
| PubChem CID | 122396219 |
| Molecular Formula | C34H44N2O2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | N,N'-bis[1-(4-methylphenyl)ethyl]hexadeca-7,9-diynediamide |
| SMILES | Cc1ccc(C(C)NC(=O)CCCCCC#CC#CCCCCCC(=O)NC(C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H44N2O2/c1-27-19-23-31(24-20-27)29(3)35-33(37)17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(38)36-30(4)32-25-21-28(2)22-26-32/h19-26,29-30H,9-18H2,1-4H3,(H,35,37)(H,36,38) |
| InChIKey | IFPVFOZSUQOWNT-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|