C28H43NO — CID 70506043
(Z)-N-(1-phenylethyl)icos-11-en-2-ynamide (PubChem CID 70506043) has the molecular formula C28H43NO and a molecular weight of 409.66 g/mol. Its IUPAC name is (Z)-N-(1-phenylethyl)icos-11-en-2-ynamide.
| Compound Name | (Z)-N-(1-phenylethyl)icos-11-en-2-ynamide |
|---|---|
| PubChem CID | 70506043 |
| Molecular Formula | C28H43NO |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | (Z)-N-(1-phenylethyl)icos-11-en-2-ynamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC#CC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C28H43NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-25-28(30)29-26(2)27-23-20-19-21-24-27/h10-11,19-21,23-24,26H,3-9,12-18H2,1-2H3,(H,29,30)/b11-10- |
| InChIKey | KSXWLKODAJGILV-KHPPLWFESA-N |
| XLogP | 7.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|