C32H42Cl5NO2 — CID 90344392
2,3,4,5,6-pentachlorophenol;(9Z,12Z)-N-(1-phenylethyl)octadeca-9,12-dienamide (PubChem CID 90344392) has the molecular formula C32H42Cl5NO2 and a molecular weight of 649.96 g/mol. Its IUPAC name is 2,3,4,5,6-pentachlorophenol;(9Z,12Z)-N-(1-phenylethyl)octadeca-9,12-dienamide.
| Compound Name | 2,3,4,5,6-pentachlorophenol;(9Z,12Z)-N-(1-phenylethyl)octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 90344392 |
| Molecular Formula | C32H42Cl5NO2 |
| Molecular Weight | 649.96 g/mol |
| Exact Mass | 647.17 |
| IUPAC Name | 2,3,4,5,6-pentachlorophenol;(9Z,12Z)-N-(1-phenylethyl)octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NC(C)c1ccccc1.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C26H41NO.C6HCl5O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-26(28)27-24(2)25-21-18-17-19-22-25;7-1-2(8)4(10)6(12)5(11)3(1)9/h7-8,10-11,17-19,21-22,24H,3-6,9,12-16,20,23H2,1-2H3,(H,27,28);12H/b8-7-,11-10-; |
| InChIKey | IPEHCDPVTITMMC-VRQRTIRHSA-N |
| XLogP | 12.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.96 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|