C16H15NO2 — CID 620039
pent-3-ynyl N-naphthalen-2-ylcarbamate (PubChem CID 620039) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is pent-3-ynyl N-naphthalen-2-ylcarbamate.
| Compound Name | pent-3-ynyl N-naphthalen-2-ylcarbamate |
|---|---|
| PubChem CID | 620039 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | pent-3-ynyl N-naphthalen-2-ylcarbamate |
| SMILES | CC#CCCOC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H15NO2/c1-2-3-6-11-19-16(18)17-15-10-9-13-7-4-5-8-14(13)12-15/h4-5,7-10,12H,6,11H2,1H3,(H,17,18) |
| InChIKey | NNZXRSNRKANWKI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|