C25H30N2O8 — CID 158664122
2-(phenylcarbamoyloxy)ethyl 3-methyl-4-[2-(2-phenylacetyl)oxyethoxycarbonylamino]butanoate (PubChem CID 158664122) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-(phenylcarbamoyloxy)ethyl 3-methyl-4-[2-(2-phenylacetyl)oxyethoxycarbonylamino]butanoate.
| Compound Name | 2-(phenylcarbamoyloxy)ethyl 3-methyl-4-[2-(2-phenylacetyl)oxyethoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 158664122 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-(phenylcarbamoyloxy)ethyl 3-methyl-4-[2-(2-phenylacetyl)oxyethoxycarbonylamino]butanoate |
| SMILES | CC(CNC(=O)OCCOC(=O)Cc1ccccc1)CC(=O)OCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H30N2O8/c1-19(16-22(28)32-13-15-35-25(31)27-21-10-6-3-7-11-21)18-26-24(30)34-14-12-33-23(29)17-20-8-4-2-5-9-20/h2-11,19H,12-18H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | QNWQPMXLMDRNAZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|