C21H27NO3 — CID 175040601
(2R)-2-(dibenzylamino)-2-(hydroxymethyl)-3,3-dimethylbutanoic acid (PubChem CID 175040601) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2R)-2-(dibenzylamino)-2-(hydroxymethyl)-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-(dibenzylamino)-2-(hydroxymethyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 175040601 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (2R)-2-(dibenzylamino)-2-(hydroxymethyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@](CO)(C(=O)O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c1-20(2,3)21(16-23,19(24)25)22(14-17-10-6-4-7-11-17)15-18-12-8-5-9-13-18/h4-13,23H,14-16H2,1-3H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | LTEPVFNUYPFDMX-OAQYLSRUSA-N |
| XLogP | 3.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |