C29H27NO2 — CID 19868014
2-[4-(dibenzylamino)phenyl]-2-phenylpropanoic acid (PubChem CID 19868014) has the molecular formula C29H27NO2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[4-(dibenzylamino)phenyl]-2-phenylpropanoic acid.
| Compound Name | 2-[4-(dibenzylamino)phenyl]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 19868014 |
| Molecular Formula | C29H27NO2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[4-(dibenzylamino)phenyl]-2-phenylpropanoic acid |
| SMILES | CC(C(=O)O)(c1ccccc1)c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H27NO2/c1-29(28(31)32,25-15-9-4-10-16-25)26-17-19-27(20-18-26)30(21-23-11-5-2-6-12-23)22-24-13-7-3-8-14-24/h2-20H,21-22H2,1H3,(H,31,32) |
| InChIKey | BHFPKPZGUHOPGW-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |