C37H40N2O2 — CID 54376838
2,2-bis[4-[ethyl(3-phenylprop-2-enyl)amino]phenyl]propanoic acid (PubChem CID 54376838) has the molecular formula C37H40N2O2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 2,2-bis[4-[ethyl(3-phenylprop-2-enyl)amino]phenyl]propanoic acid.
| Compound Name | 2,2-bis[4-[ethyl(3-phenylprop-2-enyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54376838 |
| Molecular Formula | C37H40N2O2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 2,2-bis[4-[ethyl(3-phenylprop-2-enyl)amino]phenyl]propanoic acid |
| SMILES | CCN(CC=Cc1ccccc1)c1ccc(C(C)(C(=O)O)c2ccc(N(CC)CC=Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H40N2O2/c1-4-38(28-12-18-30-14-8-6-9-15-30)34-24-20-32(21-25-34)37(3,36(40)41)33-22-26-35(27-23-33)39(5-2)29-13-19-31-16-10-7-11-17-31/h6-27H,4-5,28-29H2,1-3H3,(H,40,41) |
| InChIKey | UXCOMQHWUMYVHD-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|