C24H34N2O2 — CID 14227892
2,2-bis[4-(diethylamino)phenyl]butanoic acid (PubChem CID 14227892) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2,2-bis[4-(diethylamino)phenyl]butanoic acid.
| Compound Name | 2,2-bis[4-(diethylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 14227892 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 2,2-bis[4-(diethylamino)phenyl]butanoic acid |
| SMILES | CCN(CC)c1ccc(C(CC)(C(=O)O)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C24H34N2O2/c1-6-24(23(27)28,19-11-15-21(16-12-19)25(7-2)8-3)20-13-17-22(18-14-20)26(9-4)10-5/h11-18H,6-10H2,1-5H3,(H,27,28) |
| InChIKey | LWEMFKUVPPLZCC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|