2,2-bis[4-(diethylamino)phenyl]butanoic acid

C24H34N2O2 — CID 14227892

IUPAC2,2-bis[4-(diethylamino)phenyl]butanoic acid
SMILESCCN(CC)c1ccc(C(CC)(C(=O)O)c2ccc(N(CC)CC)cc2)cc1
InChIInChI=1S/C24H34N2O2/c1-6-24(23(27)28,19-11-15-21(16-12-19)25(7-2)8-3)20-13-17-22(18-14-20)26(9-4)10-5/h11-18H,6-10H2,1-5H3,(H,27,28)
InChIKeyLWEMFKUVPPLZCC-UHFFFAOYSA-N
MW382.55 g/mol
LogP5.16
Rot. Bonds10

About 2,2-bis[4-(diethylamino)phenyl]butanoic acid

2,2-bis[4-(diethylamino)phenyl]butanoic acid (PubChem CID 14227892) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2,2-bis[4-(diethylamino)phenyl]butanoic acid.

Molecular Properties

Compound Name2,2-bis[4-(diethylamino)phenyl]butanoic acid
PubChem CID14227892
Molecular FormulaC24H34N2O2
Molecular Weight382.55 g/mol
Exact Mass382.26
IUPAC Name2,2-bis[4-(diethylamino)phenyl]butanoic acid
SMILESCCN(CC)c1ccc(C(CC)(C(=O)O)c2ccc(N(CC)CC)cc2)cc1
InChIInChI=1S/C24H34N2O2/c1-6-24(23(27)28,19-11-15-21(16-12-19)25(7-2)8-3)20-13-17-22(18-14-20)26(9-4)10-5/h11-18H,6-10H2,1-5H3,(H,27,28)
InChIKeyLWEMFKUVPPLZCC-UHFFFAOYSA-N
XLogP5.16
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500382.55
LogP ≤ 55.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}

Analyze 2,2-bis[4-(diethylamino)phenyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis[4-(diethylamino)phenyl]butanoic acid?
The IUPAC name of 2,2-bis[4-(diethylamino)phenyl]butanoic acid (CID 14227892) is 2,2-bis[4-(diethylamino)phenyl]butanoic acid.
What is the SMILES notation for 2,2-bis[4-(diethylamino)phenyl]butanoic acid?
The canonical SMILES for 2,2-bis[4-(diethylamino)phenyl]butanoic acid is CCN(CC)c1ccc(C(CC)(C(=O)O)c2ccc(N(CC)CC)cc2)cc1.
What is the InChIKey of 2,2-bis[4-(diethylamino)phenyl]butanoic acid?
The InChIKey is LWEMFKUVPPLZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O2/c1-6-24(23(27)28,19-11-15-21(16-12-19)25(7-2)8-3)20-13-17-22(18-14-20)26(9-4)10-5/h11-18H,6-10H2,1-5H3,(H,27,28).
What are the key properties of 2,2-bis[4-(diethylamino)phenyl]butanoic acid?
2,2-bis[4-(diethylamino)phenyl]butanoic acid has a molecular weight of 382.55 g/mol, XLogP of 5.16, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis[4-(diethylamino)phenyl]butanoic acid is sourced from PubChem (CID 14227892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).