C15H17N3O2 — CID 90962387
2,2-dicyano-3-[4-(diethylamino)phenyl]propanoic acid (PubChem CID 90962387) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2,2-dicyano-3-[4-(diethylamino)phenyl]propanoic acid.
| Compound Name | 2,2-dicyano-3-[4-(diethylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 90962387 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2,2-dicyano-3-[4-(diethylamino)phenyl]propanoic acid |
| SMILES | CCN(CC)c1ccc(CC(C#N)(C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C15H17N3O2/c1-3-18(4-2)13-7-5-12(6-8-13)9-15(10-16,11-17)14(19)20/h5-8H,3-4,9H2,1-2H3,(H,19,20) |
| InChIKey | CAPOEVCRYBIGEP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|