C18H32N2 — CID 139644719
4-[2-(diethylamino)-2-methylpropyl]-N,N-diethylaniline (PubChem CID 139644719) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 4-[2-(diethylamino)-2-methylpropyl]-N,N-diethylaniline.
| Compound Name | 4-[2-(diethylamino)-2-methylpropyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 139644719 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 4-[2-(diethylamino)-2-methylpropyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CC(C)(C)N(CC)CC)cc1 |
| InChI | InChI=1S/C18H32N2/c1-7-19(8-2)17-13-11-16(12-14-17)15-18(5,6)20(9-3)10-4/h11-14H,7-10,15H2,1-6H3 |
| InChIKey | XPOAXEVGVPJGDR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|