C25H23NO — CID 139601549
N,N-bis[(E)-3-phenylprop-2-enyl]benzamide (PubChem CID 139601549) has the molecular formula C25H23NO and a molecular weight of 353.47 g/mol. Its IUPAC name is N,N-bis[(E)-3-phenylprop-2-enyl]benzamide.
| Compound Name | N,N-bis[(E)-3-phenylprop-2-enyl]benzamide |
|---|---|
| PubChem CID | 139601549 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N,N-bis[(E)-3-phenylprop-2-enyl]benzamide |
| SMILES | O=C(c1ccccc1)N(C/C=C/c1ccccc1)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H23NO/c27-25(24-18-8-3-9-19-24)26(20-10-16-22-12-4-1-5-13-22)21-11-17-23-14-6-2-7-15-23/h1-19H,20-21H2/b16-10+,17-11+ |
| InChIKey | DAFVPLCYVPVQGU-OTYYAQKOSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |