C22H24N4O — CID 46998527
N-butyl-N-[(E)-3-phenylprop-2-enyl]-4-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 46998527) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-butyl-N-[(E)-3-phenylprop-2-enyl]-4-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-butyl-N-[(E)-3-phenylprop-2-enyl]-4-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 46998527 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-butyl-N-[(E)-3-phenylprop-2-enyl]-4-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | CCCCN(C/C=C/c1ccccc1)C(=O)c1ccc(-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C22H24N4O/c1-2-3-15-26(16-7-10-18-8-5-4-6-9-18)22(27)20-13-11-19(12-14-20)21-23-17-24-25-21/h4-14,17H,2-3,15-16H2,1H3,(H,23,24,25)/b10-7+ |
| InChIKey | GFDRKXJUCHRHIF-JXMROGBWSA-N |
| XLogP | 4.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |