C18H23N5O2 — CID 70745000
3-butyl-1-methyl-4-[4-(1H-1,2,4-triazol-5-yl)benzoyl]piperazin-2-one (PubChem CID 70745000) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-butyl-1-methyl-4-[4-(1H-1,2,4-triazol-5-yl)benzoyl]piperazin-2-one.
| Compound Name | 3-butyl-1-methyl-4-[4-(1H-1,2,4-triazol-5-yl)benzoyl]piperazin-2-one |
|---|---|
| PubChem CID | 70745000 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-butyl-1-methyl-4-[4-(1H-1,2,4-triazol-5-yl)benzoyl]piperazin-2-one |
| SMILES | CCCCC1C(=O)N(C)CCN1C(=O)c1ccc(-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C18H23N5O2/c1-3-4-5-15-18(25)22(2)10-11-23(15)17(24)14-8-6-13(7-9-14)16-19-12-20-21-16/h6-9,12,15H,3-5,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | JEFUXPJNCPEUHZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |