C34H35F4N3O2 — CID 178113717
2-[[1-[benzyl(methyl)amino]-3-fluoropropan-2-yl]amino]-2-[4-(dibenzylamino)phenyl]-3,3,3-trifluoropropanoic acid (PubChem CID 178113717) has the molecular formula C34H35F4N3O2 and a molecular weight of 593.67 g/mol. Its IUPAC name is 2-[[1-[benzyl(methyl)amino]-3-fluoropropan-2-yl]amino]-2-[4-(dibenzylamino)phenyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[[1-[benzyl(methyl)amino]-3-fluoropropan-2-yl]amino]-2-[4-(dibenzylamino)phenyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 178113717 |
| Molecular Formula | C34H35F4N3O2 |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 2-[[1-[benzyl(methyl)amino]-3-fluoropropan-2-yl]amino]-2-[4-(dibenzylamino)phenyl]-3,3,3-trifluoropropanoic acid |
| SMILES | CN(Cc1ccccc1)CC(CF)NC(C(=O)O)(c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C34H35F4N3O2/c1-40(22-26-11-5-2-6-12-26)25-30(21-35)39-33(32(42)43,34(36,37)38)29-17-19-31(20-18-29)41(23-27-13-7-3-8-14-27)24-28-15-9-4-10-16-28/h2-20,30,39H,21-25H2,1H3,(H,42,43) |
| InChIKey | IBJXEOKCTXUVLD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|