C45H63N — CID 143479882
4-benzyl-N,N-bis[(3,5-ditert-butylphenyl)methyl]aniline;ethane (PubChem CID 143479882) has the molecular formula C45H63N and a molecular weight of 618.01 g/mol. Its IUPAC name is 4-benzyl-N,N-bis[(3,5-ditert-butylphenyl)methyl]aniline;ethane.
| Compound Name | 4-benzyl-N,N-bis[(3,5-ditert-butylphenyl)methyl]aniline;ethane |
|---|---|
| PubChem CID | 143479882 |
| Molecular Formula | C45H63N |
| Molecular Weight | 618.01 g/mol |
| Exact Mass | 617.50 |
| IUPAC Name | 4-benzyl-N,N-bis[(3,5-ditert-butylphenyl)methyl]aniline;ethane |
| SMILES | CC.CC(C)(C)c1cc(CN(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccc(Cc3ccccc3)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C43H57N.C2H6/c1-40(2,3)35-23-33(24-36(27-35)41(4,5)6)29-44(39-20-18-32(19-21-39)22-31-16-14-13-15-17-31)30-34-25-37(42(7,8)9)28-38(26-34)43(10,11)12;1-2/h13-21,23-28H,22,29-30H2,1-12H3;1-2H3 |
| InChIKey | MCVXFLGRUGIZBX-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.01 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|