C21H27N3O4 — CID 175480757
[(2S)-1-(2-aminoanilino)-1-oxo-3-phenylmethoxypropan-2-yl] N-tert-butylcarbamate (PubChem CID 175480757) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(2S)-1-(2-aminoanilino)-1-oxo-3-phenylmethoxypropan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2S)-1-(2-aminoanilino)-1-oxo-3-phenylmethoxypropan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175480757 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [(2S)-1-(2-aminoanilino)-1-oxo-3-phenylmethoxypropan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@@H](COCc1ccccc1)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C21H27N3O4/c1-21(2,3)24-20(26)28-18(14-27-13-15-9-5-4-6-10-15)19(25)23-17-12-8-7-11-16(17)22/h4-12,18H,13-14,22H2,1-3H3,(H,23,25)(H,24,26)/t18-/m0/s1 |
| InChIKey | KMMXXNVFTXEIRI-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|