C16H23N3O — CID 56968578
[(4R,6R)-6-azidonon-8-en-4-yl]oxymethylbenzene (PubChem CID 56968578) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is [(4R,6R)-6-azidonon-8-en-4-yl]oxymethylbenzene.
| Compound Name | [(4R,6R)-6-azidonon-8-en-4-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 56968578 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | [(4R,6R)-6-azidonon-8-en-4-yl]oxymethylbenzene |
| SMILES | C=CC[C@H](C[C@@H](CCC)OCc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C16H23N3O/c1-3-8-15(18-19-17)12-16(9-4-2)20-13-14-10-6-5-7-11-14/h3,5-7,10-11,15-16H,1,4,8-9,12-13H2,2H3/t15-,16-/m1/s1 |
| InChIKey | PCZALQDWYWCHBH-HZPDHXFCSA-N |
| XLogP | 5.02 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|