C23H27N3O2 — CID 42636691
[(1S,3R)-1-[(1S)-1-azidoethyl]-3-phenylmethoxyhept-6-ynoxy]methylbenzene (PubChem CID 42636691) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [(1S,3R)-1-[(1S)-1-azidoethyl]-3-phenylmethoxyhept-6-ynoxy]methylbenzene.
| Compound Name | [(1S,3R)-1-[(1S)-1-azidoethyl]-3-phenylmethoxyhept-6-ynoxy]methylbenzene |
|---|---|
| PubChem CID | 42636691 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | [(1S,3R)-1-[(1S)-1-azidoethyl]-3-phenylmethoxyhept-6-ynoxy]methylbenzene |
| SMILES | C#CCC[C@H](C[C@H](OCc1ccccc1)[C@H](C)N=[N+]=[N-])OCc1ccccc1 |
| InChI | InChI=1S/C23H27N3O2/c1-3-4-15-22(27-17-20-11-7-5-8-12-20)16-23(19(2)25-26-24)28-18-21-13-9-6-10-14-21/h1,5-14,19,22-23H,4,15-18H2,2H3/t19-,22+,23-/m0/s1 |
| InChIKey | MZUDDGOQVGLAIE-PMOQBDJRSA-N |
| XLogP | 5.66 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|