C18H22N3O4P — CID 11326318
(2R,3R)-3-azido-1-bis(phenylmethoxy)phosphorylbutan-2-ol (PubChem CID 11326318) has the molecular formula C18H22N3O4P and a molecular weight of 375.37 g/mol. Its IUPAC name is (2R,3R)-3-azido-1-bis(phenylmethoxy)phosphorylbutan-2-ol.
| Compound Name | (2R,3R)-3-azido-1-bis(phenylmethoxy)phosphorylbutan-2-ol |
|---|---|
| PubChem CID | 11326318 |
| Molecular Formula | C18H22N3O4P |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2R,3R)-3-azido-1-bis(phenylmethoxy)phosphorylbutan-2-ol |
| SMILES | C[C@@H](N=[N+]=[N-])[C@@H](O)CP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H22N3O4P/c1-15(20-21-19)18(22)14-26(23,24-12-16-8-4-2-5-9-16)25-13-17-10-6-3-7-11-17/h2-11,15,18,22H,12-14H2,1H3/t15-,18+/m1/s1 |
| InChIKey | VBTSEFCAQYLACU-QAPCUYQASA-N |
| XLogP | 4.67 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|