About CID 91304105
CID 91304105 (PubChem CID 91304105) has the molecular formula C17H20O6P2
and a molecular weight of 382.29 g/mol.
Molecular Properties
| Compound Name | CID 91304105 |
| PubChem CID | 91304105 |
| Molecular Formula | C17H20O6P2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | — |
| SMILES | O=P(=O)CC(O)CP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H20O6P2/c18-17(13-24(19)20)14-25(21,22-11-15-7-3-1-4-8-15)23-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | UPNRWMZNZHXFFF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 91304105 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91304105?
The IUPAC name of CID 91304105 (CID 91304105) is not available.
What is the SMILES notation for CID 91304105?
The canonical SMILES for CID 91304105 is O=P(=O)CC(O)CP(=O)(OCc1ccccc1)OCc1ccccc1.
What is the InChIKey of CID 91304105?
The InChIKey is UPNRWMZNZHXFFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O6P2/c18-17(13-24(19)20)14-25(21,22-11-15-7-3-1-4-8-15)23-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2.
What are the key properties of CID 91304105?
CID 91304105 has a molecular weight of 382.29 g/mol, XLogP of 4.15, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91304105 is sourced from PubChem (CID 91304105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).