C29H45O3P — CID 54092599
[2,12-dimethyltridecyl(phenylmethoxy)phosphoryl]oxymethylbenzene (PubChem CID 54092599) has the molecular formula C29H45O3P and a molecular weight of 472.65 g/mol. Its IUPAC name is [2,12-dimethyltridecyl(phenylmethoxy)phosphoryl]oxymethylbenzene.
| Compound Name | [2,12-dimethyltridecyl(phenylmethoxy)phosphoryl]oxymethylbenzene |
|---|---|
| PubChem CID | 54092599 |
| Molecular Formula | C29H45O3P |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | [2,12-dimethyltridecyl(phenylmethoxy)phosphoryl]oxymethylbenzene |
| SMILES | CC(C)CCCCCCCCCC(C)CP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H45O3P/c1-26(2)17-11-7-5-4-6-8-12-18-27(3)25-33(30,31-23-28-19-13-9-14-20-28)32-24-29-21-15-10-16-22-29/h9-10,13-16,19-22,26-27H,4-8,11-12,17-18,23-25H2,1-3H3 |
| InChIKey | MUWSWYTUMZDWRW-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|