C38H67NO3P2 — CID 129048059
bis(8-methylnonyl)-phenylphosphane;N-diethoxyphosphoryl-2-phenylethanamine (PubChem CID 129048059) has the molecular formula C38H67NO3P2 and a molecular weight of 647.91 g/mol. Its IUPAC name is bis(8-methylnonyl)-phenylphosphane;N-diethoxyphosphoryl-2-phenylethanamine.
| Compound Name | bis(8-methylnonyl)-phenylphosphane;N-diethoxyphosphoryl-2-phenylethanamine |
|---|---|
| PubChem CID | 129048059 |
| Molecular Formula | C38H67NO3P2 |
| Molecular Weight | 647.91 g/mol |
| Exact Mass | 647.46 |
| IUPAC Name | bis(8-methylnonyl)-phenylphosphane;N-diethoxyphosphoryl-2-phenylethanamine |
| SMILES | CC(C)CCCCCCCP(CCCCCCCC(C)C)c1ccccc1.CCOP(=O)(NCCc1ccccc1)OCC |
| InChI | InChI=1S/C26H47P.C12H20NO3P/c1-24(2)18-12-7-5-9-16-22-27(26-20-14-11-15-21-26)23-17-10-6-8-13-19-25(3)4;1-3-15-17(14,16-4-2)13-11-10-12-8-6-5-7-9-12/h11,14-15,20-21,24-25H,5-10,12-13,16-19,22-23H2,1-4H3;5-9H,3-4,10-11H2,1-2H3,(H,13,14) |
| InChIKey | WVLOTDOMIBIDTG-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.91 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|