C55H99N2O3PS2 — CID 140910818
2-[bis(9-benzylsulfanyloctadecoxy)phosphorylamino]ethyl-methanidyl-dimethylazanium (PubChem CID 140910818) has the molecular formula C55H99N2O3PS2 and a molecular weight of 931.52 g/mol. Its IUPAC name is 2-[bis(9-benzylsulfanyloctadecoxy)phosphorylamino]ethyl-methanidyl-dimethylazanium.
| Compound Name | 2-[bis(9-benzylsulfanyloctadecoxy)phosphorylamino]ethyl-methanidyl-dimethylazanium |
|---|---|
| PubChem CID | 140910818 |
| Molecular Formula | C55H99N2O3PS2 |
| Molecular Weight | 931.52 g/mol |
| Exact Mass | 930.68 |
| IUPAC Name | 2-[bis(9-benzylsulfanyloctadecoxy)phosphorylamino]ethyl-methanidyl-dimethylazanium |
| SMILES | [CH2-][N+](C)(C)CCNP(=O)(OCCCCCCCCC(CCCCCCCCC)SCc1ccccc1)OCCCCCCCCC(CCCCCCCCC)SCc1ccccc1 |
| InChI | InChI=1S/C55H99N2O3PS2/c1-6-8-10-12-14-20-32-42-54(62-50-52-38-28-26-29-39-52)44-34-22-16-18-24-36-48-59-61(58,56-46-47-57(3,4)5)60-49-37-25-19-17-23-35-45-55(43-33-21-15-13-11-9-7-2)63-51-53-40-30-27-31-41-53/h26-31,38-41,54-55H,3,6-25,32-37,42-51H2,1-2,4-5H3,(H,56,58) |
| InChIKey | LAZYNRYKLKODRJ-UHFFFAOYSA-N |
| XLogP | 17.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.52 |
| LogP ≤ 5 | 17.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|