C53H112N2O3PS2+ — CID 126737815
2-[bis(10-hexylsulfanyloctadecoxy)phosphorylamino]ethyl-trimethylazanium (PubChem CID 126737815) has the molecular formula C53H112N2O3PS2+ and a molecular weight of 920.60 g/mol. Its IUPAC name is 2-[bis(10-hexylsulfanyloctadecoxy)phosphorylamino]ethyl-trimethylazanium.
| Compound Name | 2-[bis(10-hexylsulfanyloctadecoxy)phosphorylamino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 126737815 |
| Molecular Formula | C53H112N2O3PS2+ |
| Molecular Weight | 920.60 g/mol |
| Exact Mass | 919.78 |
| IUPAC Name | 2-[bis(10-hexylsulfanyloctadecoxy)phosphorylamino]ethyl-trimethylazanium |
| SMILES | CCCCCCCCC(CCCCCCCCCOP(=O)(NCC[N+](C)(C)C)OCCCCCCCCCC(CCCCCCCC)SCCCCCC)SCCCCCC |
| InChI | InChI=1S/C53H112N2O3PS2/c1-8-12-16-20-28-34-42-52(60-50-40-18-14-10-3)44-36-30-24-22-26-32-38-48-57-59(56,54-46-47-55(5,6)7)58-49-39-33-27-23-25-31-37-45-53(61-51-41-19-15-11-4)43-35-29-21-17-13-9-2/h52-53H,8-51H2,1-7H3,(H,54,56)/q+1 |
| InChIKey | GQBPLVKUCRYXHI-UHFFFAOYSA-N |
| XLogP | 18.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.60 |
| LogP ≤ 5 | 18.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|