C25H55N2O3P — CID 169075508
N-didecoxyphosphoryl-N',N'-dimethylpropane-1,3-diamine (PubChem CID 169075508) has the molecular formula C25H55N2O3P and a molecular weight of 462.70 g/mol. Its IUPAC name is N-didecoxyphosphoryl-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-didecoxyphosphoryl-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 169075508 |
| Molecular Formula | C25H55N2O3P |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.40 |
| IUPAC Name | N-didecoxyphosphoryl-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCCCCCCCCCOP(=O)(NCCCN(C)C)OCCCCCCCCCC |
| InChI | InChI=1S/C25H55N2O3P/c1-5-7-9-11-13-15-17-19-24-29-31(28,26-22-21-23-27(3)4)30-25-20-18-16-14-12-10-8-6-2/h5-25H2,1-4H3,(H,26,28) |
| InChIKey | LBWPFXWBKIOUIK-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|