C41H84AsINO3P — CID 10485818
2-[bis[(E)-octadec-9-enoxy]phosphorylamino]ethyl-trimethylarsanium iodide (PubChem CID 10485818) has the molecular formula C41H84AsINO3P and a molecular weight of 871.93 g/mol. Its IUPAC name is 2-[bis[(E)-octadec-9-enoxy]phosphorylamino]ethyl-trimethylarsanium iodide.
| Compound Name | 2-[bis[(E)-octadec-9-enoxy]phosphorylamino]ethyl-trimethylarsanium iodide |
|---|---|
| PubChem CID | 10485818 |
| Molecular Formula | C41H84AsINO3P |
| Molecular Weight | 871.93 g/mol |
| Exact Mass | 871.44 |
| IUPAC Name | 2-[bis[(E)-octadec-9-enoxy]phosphorylamino]ethyl-trimethylarsanium iodide |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOP(=O)(NCC[As+](C)(C)C)OCCCCCCCC/C=C/CCCCCCCC.[I-] |
| InChI | InChI=1S/C41H84AsNO3P.HI/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40-45-47(44,43-39-38-42(3,4)5)46-41-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23H,6-19,24-41H2,1-5H3,(H,43,44);1H/q+1;/p-1/b22-20+,23-21+; |
| InChIKey | QVBJWLGDBDQWGH-AFLLVNNISA-M |
| XLogP | 12.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.93 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|