C46H97N2O5PS2 — CID 126737832
3-[18-[[2-(dimethylamino)ethylamino]-[9-(3-hydroxypropylsulfanyl)octadecoxy]phosphoryl]oxyoctadecan-9-ylsulfanyl]propan-1-ol (PubChem CID 126737832) has the molecular formula C46H97N2O5PS2 and a molecular weight of 853.40 g/mol. Its IUPAC name is 3-[18-[[2-(dimethylamino)ethylamino]-[9-(3-hydroxypropylsulfanyl)octadecoxy]phosphoryl]oxyoctadecan-9-ylsulfanyl]propan-1-ol.
| Compound Name | 3-[18-[[2-(dimethylamino)ethylamino]-[9-(3-hydroxypropylsulfanyl)octadecoxy]phosphoryl]oxyoctadecan-9-ylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 126737832 |
| Molecular Formula | C46H97N2O5PS2 |
| Molecular Weight | 853.40 g/mol |
| Exact Mass | 852.66 |
| IUPAC Name | 3-[18-[[2-(dimethylamino)ethylamino]-[9-(3-hydroxypropylsulfanyl)octadecoxy]phosphoryl]oxyoctadecan-9-ylsulfanyl]propan-1-ol |
| SMILES | CCCCCCCCCC(CCCCCCCCOP(=O)(NCCN(C)C)OCCCCCCCCCC(CCCCCCCC)SCCCO)SCCCO |
| InChI | InChI=1S/C46H97N2O5PS2/c1-5-7-9-11-14-20-26-34-46(56-44-32-40-50)36-28-22-16-18-24-30-42-53-54(51,47-37-38-48(3)4)52-41-29-23-17-13-15-21-27-35-45(55-43-31-39-49)33-25-19-12-10-8-6-2/h45-46,49-50H,5-44H2,1-4H3,(H,47,51) |
| InChIKey | HALQTNAYGWIGAJ-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.40 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|