C37H79N2O4P — CID 166006071
2-[2-[bis(2-hexyldecoxy)phosphorylamino]ethyl-methylamino]ethanol (PubChem CID 166006071) has the molecular formula C37H79N2O4P and a molecular weight of 647.02 g/mol. Its IUPAC name is 2-[2-[bis(2-hexyldecoxy)phosphorylamino]ethyl-methylamino]ethanol.
| Compound Name | 2-[2-[bis(2-hexyldecoxy)phosphorylamino]ethyl-methylamino]ethanol |
|---|---|
| PubChem CID | 166006071 |
| Molecular Formula | C37H79N2O4P |
| Molecular Weight | 647.02 g/mol |
| Exact Mass | 646.58 |
| IUPAC Name | 2-[2-[bis(2-hexyldecoxy)phosphorylamino]ethyl-methylamino]ethanol |
| SMILES | CCCCCCCCC(CCCCCC)COP(=O)(NCCN(C)CCO)OCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C37H79N2O4P/c1-6-10-14-18-20-24-28-36(26-22-16-12-8-3)34-42-44(41,38-30-31-39(5)32-33-40)43-35-37(27-23-17-13-9-4)29-25-21-19-15-11-7-2/h36-37,40H,6-35H2,1-5H3,(H,38,41) |
| InChIKey | WISHTRFGSNFDTC-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.02 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|