C55H111N2O7P — CID 166006076
heptadecan-9-yl 8-[[3-(dimethylamino)propylamino]-(8-heptadecan-9-yloxy-8-oxooctoxy)phosphoryl]oxyoctanoate (PubChem CID 166006076) has the molecular formula C55H111N2O7P and a molecular weight of 943.47 g/mol. Its IUPAC name is heptadecan-9-yl 8-[[3-(dimethylamino)propylamino]-(8-heptadecan-9-yloxy-8-oxooctoxy)phosphoryl]oxyoctanoate.
| Compound Name | heptadecan-9-yl 8-[[3-(dimethylamino)propylamino]-(8-heptadecan-9-yloxy-8-oxooctoxy)phosphoryl]oxyoctanoate |
|---|---|
| PubChem CID | 166006076 |
| Molecular Formula | C55H111N2O7P |
| Molecular Weight | 943.47 g/mol |
| Exact Mass | 942.81 |
| IUPAC Name | heptadecan-9-yl 8-[[3-(dimethylamino)propylamino]-(8-heptadecan-9-yloxy-8-oxooctoxy)phosphoryl]oxyoctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOP(=O)(NCCCN(C)C)OCCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C55H111N2O7P/c1-7-11-15-19-25-33-42-52(43-34-26-20-16-12-8-2)63-54(58)46-37-29-23-31-39-50-61-65(60,56-48-41-49-57(5)6)62-51-40-32-24-30-38-47-55(59)64-53(44-35-27-21-17-13-9-3)45-36-28-22-18-14-10-4/h52-53H,7-51H2,1-6H3,(H,56,60) |
| InChIKey | HFPCIUKAEGWJQG-UHFFFAOYSA-N |
| XLogP | 17.18 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.47 |
| LogP ≤ 5 | 17.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|