About heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate
heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate (PubChem CID 166927405) has the molecular formula C31H63N2O5P
and a molecular weight of 574.83 g/mol. Its IUPAC name is heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate.
Molecular Properties
| Compound Name | heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate |
| PubChem CID | 166927405 |
| Molecular Formula | C31H63N2O5P |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.45 |
| IUPAC Name | heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOP(=O)(NCCN1CCC1)OC |
| InChI | InChI=1S/C31H63N2O5P/c1-4-6-8-10-13-17-22-30(23-18-14-11-9-7-5-2)38-31(34)24-19-15-12-16-20-29-37-39(35,36-3)32-25-28-33-26-21-27-33/h30H,4-29H2,1-3H3,(H,32,35) |
| InChIKey | BXZHQUYBURQNJI-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate?
The IUPAC name of heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate (CID 166927405) is heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate.
What is the SMILES notation for heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate?
The canonical SMILES for heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate is CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOP(=O)(NCCN1CCC1)OC.
What is the InChIKey of heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate?
The InChIKey is BXZHQUYBURQNJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H63N2O5P/c1-4-6-8-10-13-17-22-30(23-18-14-11-9-7-5-2)38-31(34)24-19-15-12-16-20-29-37-39(35,36-3)32-25-28-33-26-21-27-33/h30H,4-29H2,1-3H3,(H,32,35).
What are the key properties of heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate?
heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate has a molecular weight of 574.83 g/mol, XLogP of 8.81, 29 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecan-9-yl 8-[[2-(azetidin-1-yl)ethylamino]-methoxyphosphoryl]oxyoctanoate is sourced from PubChem (CID 166927405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).