C47H60O6 — CID 10963623
(2S,4S,5R,11S,13S,14R,15R)-11,15-dimethyl-2,4,5,14-tetrakis(phenylmethoxy)heptadec-8-yne-1,13-diol (PubChem CID 10963623) has the molecular formula C47H60O6 and a molecular weight of 720.99 g/mol. Its IUPAC name is (2S,4S,5R,11S,13S,14R,15R)-11,15-dimethyl-2,4,5,14-tetrakis(phenylmethoxy)heptadec-8-yne-1,13-diol.
| Compound Name | (2S,4S,5R,11S,13S,14R,15R)-11,15-dimethyl-2,4,5,14-tetrakis(phenylmethoxy)heptadec-8-yne-1,13-diol |
|---|---|
| PubChem CID | 10963623 |
| Molecular Formula | C47H60O6 |
| Molecular Weight | 720.99 g/mol |
| Exact Mass | 720.44 |
| IUPAC Name | (2S,4S,5R,11S,13S,14R,15R)-11,15-dimethyl-2,4,5,14-tetrakis(phenylmethoxy)heptadec-8-yne-1,13-diol |
| SMILES | CC[C@@H](C)[C@@H](OCc1ccccc1)[C@@H](O)C[C@@H](C)CC#CCC[C@@H](OCc1ccccc1)[C@H](C[C@@H](CO)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C47H60O6/c1-4-38(3)47(53-36-42-27-17-9-18-28-42)44(49)30-37(2)20-10-5-19-29-45(51-34-40-23-13-7-14-24-40)46(52-35-41-25-15-8-16-26-41)31-43(32-48)50-33-39-21-11-6-12-22-39/h6-9,11-18,21-28,37-38,43-49H,4,19-20,29-36H2,1-3H3/t37-,38+,43-,44-,45+,46-,47+/m0/s1 |
| InChIKey | VMMWTFDQIGPTAN-MVAUIFNESA-N |
| XLogP | 9.32 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.99 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|