C17H28O2 — CID 101222253
(2S,4S)-4-methyl-2-[(1R)-1-phenylmethoxypropyl]hexan-1-ol (PubChem CID 101222253) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (2S,4S)-4-methyl-2-[(1R)-1-phenylmethoxypropyl]hexan-1-ol.
| Compound Name | (2S,4S)-4-methyl-2-[(1R)-1-phenylmethoxypropyl]hexan-1-ol |
|---|---|
| PubChem CID | 101222253 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (2S,4S)-4-methyl-2-[(1R)-1-phenylmethoxypropyl]hexan-1-ol |
| SMILES | CC[C@H](C)C[C@@H](CO)[C@@H](CC)OCc1ccccc1 |
| InChI | InChI=1S/C17H28O2/c1-4-14(3)11-16(12-18)17(5-2)19-13-15-9-7-6-8-10-15/h6-10,14,16-18H,4-5,11-13H2,1-3H3/t14-,16-,17+/m0/s1 |
| InChIKey | KYHOWJGPESZAHJ-BHYGNILZSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |