C17H23F2NO3 — CID 24713954
1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 24713954) has the molecular formula C17H23F2NO3 and a molecular weight of 327.37 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 24713954 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)CN(CCCOC)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C17H23F2NO3/c1-3-8-23-13-16(21)12-20(7-4-9-22-2)11-14-5-6-15(18)10-17(14)19/h1,5-6,10,16,21H,4,7-9,11-13H2,2H3 |
| InChIKey | FPKXASXATOTSPX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|