C17H23F2NO2 — CID 93162622
(2S)-1-[(2,4-difluorophenyl)methyl-(2-methylpropyl)amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 93162622) has the molecular formula C17H23F2NO2 and a molecular weight of 311.37 g/mol. Its IUPAC name is (2S)-1-[(2,4-difluorophenyl)methyl-(2-methylpropyl)amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | (2S)-1-[(2,4-difluorophenyl)methyl-(2-methylpropyl)amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 93162622 |
| Molecular Formula | C17H23F2NO2 |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (2S)-1-[(2,4-difluorophenyl)methyl-(2-methylpropyl)amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOC[C@@H](O)CN(Cc1ccc(F)cc1F)CC(C)C |
| InChI | InChI=1S/C17H23F2NO2/c1-4-7-22-12-16(21)11-20(9-13(2)3)10-14-5-6-15(18)8-17(14)19/h1,5-6,8,13,16,21H,7,9-12H2,2-3H3/t16-/m0/s1 |
| InChIKey | GULGWMWZGZBQFG-INIZCTEOSA-N |
| XLogP | 2.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|