C18H25F2NO2 — CID 42837102
1-[(2,4-difluorophenyl)methyl-(3-methylbutyl)amino]-3-prop-2-ynoxypropan-2-ol (PubChem CID 42837102) has the molecular formula C18H25F2NO2 and a molecular weight of 325.40 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl-(3-methylbutyl)amino]-3-prop-2-ynoxypropan-2-ol.
| Compound Name | 1-[(2,4-difluorophenyl)methyl-(3-methylbutyl)amino]-3-prop-2-ynoxypropan-2-ol |
|---|---|
| PubChem CID | 42837102 |
| Molecular Formula | C18H25F2NO2 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl-(3-methylbutyl)amino]-3-prop-2-ynoxypropan-2-ol |
| SMILES | C#CCOCC(O)CN(CCC(C)C)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C18H25F2NO2/c1-4-9-23-13-17(22)12-21(8-7-14(2)3)11-15-5-6-16(19)10-18(15)20/h1,5-6,10,14,17,22H,7-9,11-13H2,2-3H3 |
| InChIKey | WRSWEAMNULQHAH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|