C20H30FN2O2+ — CID 7399893
[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxybutyl]-(3-methoxypropyl)azanium (PubChem CID 7399893) has the molecular formula C20H30FN2O2+ and a molecular weight of 349.47 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxybutyl]-(3-methoxypropyl)azanium.
| Compound Name | [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxybutyl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 7399893 |
| Molecular Formula | C20H30FN2O2+ |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxybutyl]-(3-methoxypropyl)azanium |
| SMILES | CC[C@@H](O)C[NH+](CCCOC)Cc1cccn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H29FN2O2/c1-3-20(24)16-22(10-6-12-25-2)15-19-9-5-11-23(19)14-17-7-4-8-18(21)13-17/h4-5,7-9,11,13,20,24H,3,6,10,12,14-16H2,1-2H3/p+1/t20-/m1/s1 |
| InChIKey | DYMRIIBFKJPUMN-HXUWFJFHSA-O |
| XLogP | 1.87 |
| TPSA | 38.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|