C25H30N3O+ — CID 7364676
(3-cyanophenyl)methyl-(3-methoxypropyl)-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]azanium (PubChem CID 7364676) has the molecular formula C25H30N3O+ and a molecular weight of 388.54 g/mol. Its IUPAC name is (3-cyanophenyl)methyl-(3-methoxypropyl)-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]azanium.
| Compound Name | (3-cyanophenyl)methyl-(3-methoxypropyl)-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7364676 |
| Molecular Formula | C25H30N3O+ |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (3-cyanophenyl)methyl-(3-methoxypropyl)-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]azanium |
| SMILES | COCCC[NH+](Cc1cccc(C#N)c1)Cc1cccn1Cc1ccccc1C |
| InChI | InChI=1S/C25H29N3O/c1-21-8-3-4-11-24(21)19-28-14-6-12-25(28)20-27(13-7-15-29-2)18-23-10-5-9-22(16-23)17-26/h3-6,8-12,14,16H,7,13,15,18-20H2,1-2H3/p+1 |
| InChIKey | CEIKULNQAJIWBE-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 42.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|