C24H37N2O+ — CID 7205882
(1-benzylpyrrol-2-yl)methyl-(cyclohexylmethyl)-[(2S)-2-hydroxypentyl]azanium (PubChem CID 7205882) has the molecular formula C24H37N2O+ and a molecular weight of 369.57 g/mol. Its IUPAC name is (1-benzylpyrrol-2-yl)methyl-(cyclohexylmethyl)-[(2S)-2-hydroxypentyl]azanium.
| Compound Name | (1-benzylpyrrol-2-yl)methyl-(cyclohexylmethyl)-[(2S)-2-hydroxypentyl]azanium |
|---|---|
| PubChem CID | 7205882 |
| Molecular Formula | C24H37N2O+ |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | (1-benzylpyrrol-2-yl)methyl-(cyclohexylmethyl)-[(2S)-2-hydroxypentyl]azanium |
| SMILES | CCC[C@H](O)C[NH+](Cc1cccn1Cc1ccccc1)CC1CCCCC1 |
| InChI | InChI=1S/C24H36N2O/c1-2-10-24(27)20-25(17-21-11-5-3-6-12-21)19-23-15-9-16-26(23)18-22-13-7-4-8-14-22/h4,7-9,13-16,21,24,27H,2-3,5-6,10-12,17-20H2,1H3/p+1/t24-/m0/s1 |
| InChIKey | ZHVDRKSBKNCTAW-DEOSSOPVSA-O |
| XLogP | 3.66 |
| TPSA | 29.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |