C24H35FN2O — CID 7364924
(2S)-1-[cyclohexylmethyl-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]pentan-2-ol (PubChem CID 7364924) has the molecular formula C24H35FN2O and a molecular weight of 386.56 g/mol. Its IUPAC name is (2S)-1-[cyclohexylmethyl-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]pentan-2-ol.
| Compound Name | (2S)-1-[cyclohexylmethyl-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 7364924 |
| Molecular Formula | C24H35FN2O |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2S)-1-[cyclohexylmethyl-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]pentan-2-ol |
| SMILES | CCC[C@H](O)CN(Cc1cccn1Cc1ccccc1F)CC1CCCCC1 |
| InChI | InChI=1S/C24H35FN2O/c1-2-9-23(28)19-26(16-20-10-4-3-5-11-20)18-22-13-8-15-27(22)17-21-12-6-7-14-24(21)25/h6-8,12-15,20,23,28H,2-5,9-11,16-19H2,1H3/t23-/m0/s1 |
| InChIKey | CNAYPCTXOGQYTF-QHCPKHFHSA-N |
| XLogP | 5.22 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |