C25H35FN2O — CID 93116188
(2R)-1-[cyclohexylmethyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]hex-5-en-2-ol (PubChem CID 93116188) has the molecular formula C25H35FN2O and a molecular weight of 398.57 g/mol. Its IUPAC name is (2R)-1-[cyclohexylmethyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]hex-5-en-2-ol.
| Compound Name | (2R)-1-[cyclohexylmethyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93116188 |
| Molecular Formula | C25H35FN2O |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (2R)-1-[cyclohexylmethyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@@H](O)CN(Cc1cccn1Cc1ccc(F)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C25H35FN2O/c1-2-3-11-25(29)20-27(17-21-8-5-4-6-9-21)19-24-10-7-16-28(24)18-22-12-14-23(26)15-13-22/h2,7,10,12-16,21,25,29H,1,3-6,8-9,11,17-20H2/t25-/m1/s1 |
| InChIKey | QOBOXFRWYBHPJF-RUZDIDTESA-N |
| XLogP | 5.38 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|