C21H31FN2O — CID 7297443
(2S)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl-(3-methylbutyl)amino]butan-2-ol (PubChem CID 7297443) has the molecular formula C21H31FN2O and a molecular weight of 346.49 g/mol. Its IUPAC name is (2S)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl-(3-methylbutyl)amino]butan-2-ol.
| Compound Name | (2S)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl-(3-methylbutyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 7297443 |
| Molecular Formula | C21H31FN2O |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (2S)-1-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl-(3-methylbutyl)amino]butan-2-ol |
| SMILES | CC[C@H](O)CN(CCC(C)C)Cc1cccn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H31FN2O/c1-4-21(25)16-23(13-11-17(2)3)15-20-6-5-12-24(20)14-18-7-9-19(22)10-8-18/h5-10,12,17,21,25H,4,11,13-16H2,1-3H3/t21-/m0/s1 |
| InChIKey | HTGJQZVDWVTSPY-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |