C26H42N2O — CID 42794821
1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-(3-methylbutyl)amino]pentan-2-ol (PubChem CID 42794821) has the molecular formula C26H42N2O and a molecular weight of 398.64 g/mol. Its IUPAC name is 1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-(3-methylbutyl)amino]pentan-2-ol.
| Compound Name | 1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-(3-methylbutyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 42794821 |
| Molecular Formula | C26H42N2O |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | 1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-(3-methylbutyl)amino]pentan-2-ol |
| SMILES | CCCC(O)CN(CCC(C)C)Cc1cccn1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H42N2O/c1-7-9-25(29)20-27(17-15-21(2)3)19-24-10-8-16-28(24)18-22-11-13-23(14-12-22)26(4,5)6/h8,10-14,16,21,25,29H,7,9,15,17-20H2,1-6H3 |
| InChIKey | LGKXTXXUQIVKBQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |